The red-fluorescentLissamine rhodamine B sulfonyl chloride is an amine reactive dye. Its fluorescence emission spectrum lies between those of tetramethylrhodamines and X-rhodamines, and it can be well excited by 568 nm line of the Ar-Kr mixed gas laser that is used in many confocal laser-scanning microscopes.
Product Name: | Lissamine rhodamine B sulfonyl chloride |
Synonyms: | Sulforhodamine B sulfonyl chloride |
CAS Number: | 62796-29-6 |
Molecular Formula: | C27H29ClN2O6S2 |
Molecular Weight: | 577.11 |
SMILES: | CN(C)C1=CC=C2C(OC3=CC(C=CC3=C2C2=CC=C(C=C2C([O-])=O)C(=O)NCCOCCOCCOCCN=[N+]=[N-])=[N+](C)C)=C3 |
Purity (HPLC): | ≥ 90% |
Shipping Conditions: | room temperature |
Storage Conditions: | Refrigerated |
Regulatory Statement: | For Research Use Only |