The red-fluorescent Lissamine rhodamine B C2 maleimide is a thiol reactive dye. Its fluorescence emission spectrum lies between those of tetramethylrhodamines and X-rhodamines, and it can be well excited by 568 nm line of the Ar-Kr mixed gas laser that is used in many confocal laser-scanning microscopes.
Product Name: | Lissamine rhodamine B C2 maleimide |
Synonyms: | Sulforhodamine B C2 maleimide |
CAS Number: | 1800246-48-3 |
Molecular Formula: | C33H36N4O8S2 |
Molecular Weight: | 680.79 |
SMILES: | CN(C)C1=CC=C2C(OC3=CC(C=CC3=C2C2=CC=C(C=C2C([O-])=O)C(=O)NCCOCCOCCOCCN=[N+]=[N-])=[N+](C)C)=C2 |
Purity (HPLC): | ≥ 95% |
Shipping Conditions: | room temperature |
Storage Conditions: | Refrigerated |
Regulatory Statement: | For Research Use Only |