Loading...
Tenova Pharmaceuticals | SKU:
T01162-5mg
Lissamine rhodamine B azide
$159.00
Unit price
/
Unavailable
Lissamine rhodamine B azide - 5mg is backordered and will ship as soon as it is back in stock.
Couldn't load pickup availability
Lissamine rhodamine B azide
$159.00
Unit price
/
Unavailable
Sulforhodamine B azide (Lissamine rhodamine B azide) is an excellent alkyne-reactive fluorescent reagent for labeling alkyne-containing biological molecules through click chemistry. The fluorescence emission spectrum of Lissamine rhodamine B lies between those of tetramethylrhodamines and X-rhodamines, and it can be well excited by 568 nm line of the Ar-Kr mixed gas laser that is used in many confocal laser-scanning microscopes.
| Product Name: | Lissamine rhodamine B azide |
| Synonyms: | Sulforhodamine B azide |
| CAS Number: | N/A |
| Molecular Formula: | C30H72N12O12S4 |
| Molecular Weight: | 640.77 |
| SMILES: | CCN(CC)C1=CC=C2C(OC3=CC(C=CC3=C2C2=CC=C(C=C2S([O-])(=O)=O)S(=O)(=O)NCCCN=[N]#N)=[N+](CC)CC)=C1 |
| Purity (HPLC): | ≥ 95% |
| Shipping Conditions: | room temperature |
| Storage Conditions: | Refrigerated |
| Regulatory Statement: | For Research Use Only |
