Loading...
Tenova Pharmaceuticals | SKU:
T01197-100mg
Lissamine rhodamine B sulfonyl chloride
$109.00
Unit price
/
Unavailable
Lissamine rhodamine B sulfonyl chloride - 100mg is backordered and will ship as soon as it is back in stock.
Couldn't load pickup availability
The red-fluorescentLissamine rhodamine B sulfonyl chloride is an amine reactive dye. Its fluorescence emission spectrum lies between those of tetramethylrhodamines and X-rhodamines, and it can be well excited by 568 nm line of the Ar-Kr mixed gas laser that is used in many confocal laser-scanning microscopes.
| Product Name: | Lissamine rhodamine B sulfonyl chloride |
| Synonyms: | Sulforhodamine B sulfonyl chloride |
| CAS Number: | 62796-29-6 |
| Molecular Formula: | C27H29ClN2O6S2 |
| Molecular Weight: | 577.11 |
| SMILES: | CN(C)C1=CC=C2C(OC3=CC(C=CC3=C2C2=CC=C(C=C2C([O-])=O)C(=O)NCCOCCOCCOCCN=[N+]=[N-])=[N+](C)C)=C3 |
| Purity (HPLC): | ≥ 90% |
| Shipping Conditions: | room temperature |
| Storage Conditions: | Refrigerated |
| Regulatory Statement: | For Research Use Only |
