Loading...
Tenova Pharmaceuticals | SKU:
T01196-5mg
Lissamine rhodamine B C2 maleimide
Regular price
$159.00
Unit price
/
Unavailable
Lissamine rhodamine B C2 maleimide - 5mg is backordered and will ship as soon as it is back in stock.
Couldn't load pickup availability
Lissamine rhodamine B C2 maleimide
Regular price
$159.00
Unit price
/
Unavailable
The red-fluorescent Lissamine rhodamine B C2 maleimide is a thiol reactive dye. Its fluorescence emission spectrum lies between those of tetramethylrhodamines and X-rhodamines, and it can be well excited by 568 nm line of the Ar-Kr mixed gas laser that is used in many confocal laser-scanning microscopes.
| Product Name: | Lissamine rhodamine B C2 maleimide |
| Synonyms: | Sulforhodamine B C2 maleimide |
| CAS Number: | 1800246-48-3 |
| Molecular Formula: | C33H36N4O8S2 |
| Molecular Weight: | 680.79 |
| SMILES: | CN(C)C1=CC=C2C(OC3=CC(C=CC3=C2C2=CC=C(C=C2C([O-])=O)C(=O)NCCOCCOCCOCCN=[N+]=[N-])=[N+](C)C)=C2 |
| Purity (HPLC): | ≥ 95% |
| Shipping Conditions: | room temperature |
| Storage Conditions: | Refrigerated |
| Regulatory Statement: | For Research Use Only |
