Proteolysis targeting chimera (PROTAC) building block. Contains an E3 ligase ligand with alkyl linker and terminal alcohol. Ready for conjugation to a target protein ligand to form PROTACs containing Lenalidomide as cereblon ligand.
| Product Name: | Lenalidomide-C3-OH |
| Synonyms: | 2,?6-?Piperidinedione, 3-?[1,?3-?dihydro-?4-?[(3-?hydroxypropyl)?amino]?-?1-?oxo-?2H-?isoindol-?2-?yl]?- |
| CAS Number: | 2301126-97-4 |
| Molecular Formula: | C16H19N3O4 |
| Molecular Weight: | 317.345 |
| SMILES: | OCCCNC1=C2CN(C3CCC(=O)NC3=O)C(=O)C2=CC=C1 |
| Purity (HPLC): | 95% |
| Shipping Conditions: | room temperature |
| Storage Conditions: | Refrigerated |
| Regulatory Statement: | For Research Use Only |