Proteolysis targeting chimera (PROTAC) building block. Contains an E3 ligase ligand with alkyl linker and terminal azide. Ready for conjugation to a target protein ligand through click chemistry to form PROTACs containing Lenalidomide as cereblon ligand.
| Product Name: | Lenalidomide-C4-azide |
| Synonyms: | 3-[4-[(4-Azidobutyl)amino]-1,3-dihydro-1-oxo-2H-isoindol-2-yl]-2,6-piperidinedione |
| CAS Number: | 2138441-39-9 |
| Molecular Formula: | C17H20N6O3 |
| Molecular Weight: | 356.386 |
| SMILES: | [N-]=[N+]=NCCCCNC1=C2CN(C3CCC(=O)NC3=O)C(=O)C2=CC=C1 |
| Purity (HPLC): | 95% |
| Shipping Conditions: | room temperature |
| Storage Conditions: | Refrigerated |
| Regulatory Statement: | For Research Use Only |