Proteolysis targeting chimera (PROTAC) building block. Contains an E3 ligase ligand with alkyl linker and terminal carboxylic acid. Ready for conjugation to a target protein ligand to form PROTACs containing Lenalidomide as cereblon ligand.
| Product Name: | Lenalidomide-C5-acid |
| Synonyms: | Hexanoic acid, 6-?[[2-?(2,?6-?dioxo-?3-?piperidinyl)?-?2,?3-?dihydro-?1-?oxo-?1H-?isoindol-?4-?yl]?amino]?- |
| CAS Number: | 2338824-30-7 |
| Molecular Formula: | C19H23N3O5 |
| Molecular Weight: | 373.409 |
| SMILES: | OC(=O)CCCCCNC1=C2CN(C3CCC(=O)NC3=O)C(=O)C2=CC=C1 |
| Purity (HPLC): | 95% |
| Shipping Conditions: | room temperature |
| Storage Conditions: | Refrigerated |
| Regulatory Statement: | For Research Use Only |