Proteolysis targeting chimera (PROTAC) building block. Contains an E3 ligase ligand with PEG linker and terminal carboxylic acid. Ready for conjugation to a target protein ligand to form PROTACs containing Lenalidomide as cereblon ligand.
| Product Name: | Lenalidomide-PEG1-C2-acid |
| Synonyms: | 3-[2-[[2-(2,6-Dioxo-3-piperidinyl)-2,3-dihydro-1-oxo-1H-isoindol-4-yl]amino]ethoxy]propanoic acid |
| CAS Number: | 2225148-47-8 |
| Molecular Formula: | C18H21N3O6 |
| Molecular Weight: | 375.381 |
| SMILES: | OC(=O)CCOCCNC1=C2CN(C3CCC(=O)NC3=O)C(=O)C2=CC=C1 |
| Purity (HPLC): | 95% |
| Shipping Conditions: | room temperature |
| Storage Conditions: | Refrigerated |
| Regulatory Statement: | For Research Use Only |