Proteolysis targeting chimera (PROTAC) building block. Contains an E3 ligase ligand with PEG linker and terminal azide. Ready for conjugation to a target protein ligand through click chemistry to form PROTACs containing Lenalidomide as cereblon ligand.
| Product Name: | Lenalidomide-PEG1-C2-azide |
| Synonyms: | 2,?6-?Piperidinedione, 3-?[4-?[[2-?(2-?azidoethoxy)?ethyl]?amino]?-?1,?3-?dihydro-?1-?oxo-?2H-?isoindol-?2-?yl]?- |
| CAS Number: | 2399455-45-7 |
| Molecular Formula: | C17H20N6O4 |
| Molecular Weight: | 372.385 |
| SMILES: | [N-]=[N+]=NCCOCCNC1=C2CN(C3CCC(=O)NC3=O)C(=O)C2=CC=C1 |
| Purity (HPLC): | 95% |
| Shipping Conditions: | room temperature |
| Storage Conditions: | Refrigerated |
| Regulatory Statement: | For Research Use Only |