Lenalidomide-PEG4-C2-amine HCl
$490.00
SKU: T52286-50mg
Proteolysis targeting chimera (PROTAC) building block. Contains an E3 ligase ligand with PEG linker and terminal amine. Ready for conjugation to a target protein ligand to form PROTACs containing Lenalidomide as cereblon ligand.
| Product Name: | Lenalidomide-PEG4-C2-amine HCl |
| Synonyms: | 2,?6-?Piperidinedione, 3-?[4-?[(14-?amino-?3,?6,?9,?12-?tetraoxatetradec-?1-?yl)?amino]?-?1,?3-?dihydro-?1-?oxo-?2H-?isoindol-?2-?yl]?- |
| CAS Number: | 2243089-93-0 |
| Molecular Formula: | C23H35ClN4O7 |
| Molecular Weight: | 515 |
| SMILES: | Cl.NCCOCCOCCOCCOCCNC1=C2CN(C3CCC(=O)NC3=O)C(=O)C2=CC=C1 |
| Purity (HPLC): | 95% |
| Shipping Conditions: | room temperature |
| Storage Conditions: | Refrigerated |
| Regulatory Statement: | For Research Use Only |