Proteolysis targeting chimera (PROTAC) building block. Contains an E3 ligase ligand with PEG linker and terminal alcohol. Ready for conjugation to a target protein ligand to form PROTACs containing Lenalidomide as cereblon ligand.
| Product Name: | Lenalidomide-PEG6-OH |
| Synonyms: | 2,?6-?Piperidinedione, 3-?[1,?3-?dihydro-?4-?[(17-?hydroxy-?3,?6,?9,?12,?15-?pentaoxaheptadec-?1-?yl)?amino]?-?1-?oxo-?2H-?isoindol-?2-?yl]?- |
| CAS Number: | 2136248-24-1 |
| Molecular Formula: | C25H37N3O9 |
| Molecular Weight: | 523.583 |
| SMILES: | OCCOCCOCCOCCOCCOCCNC1=C2CN(C3CCC(=O)NC3=O)C(=O)C2=CC=C1 |
| Purity (HPLC): | 95% |
| Shipping Conditions: | room temperature |
| Storage Conditions: | Refrigerated |
| Regulatory Statement: | For Research Use Only |