Lissamine Rhodamine B Ethylenediamine
Lissamine Rhodamine B Ethylenediamine - 10mg is backordered and will ship as soon as it is back in stock.
Couldn't load pickup availability
Lissamine Rhodamine B Ethylenediamine
The red-fluorescent Lissamine Rhodamine B Ethylenediamine is a mixture of isomers. It is used for modifying carboxy-containing biomolecules. It can also be reversibly coupled to aldehydes and ketones to form a Schiff base - which can be reduced to a generate stable amine derivative by sodium borohydride (NaBH4) or sodium cyanoborohydride (NaCNH3). Its fluorescence emission spectrum lies between those of tetramethylrhodamines and X-rhodamines, and it can be well excited by 568 nm line of the Ar-Kr mixed gas laser that is used in many confocal laser-scanning microscopes.
| Product Name: | Lissamine Rhodamine B Ethylenediamine |
| Synonyms: | Sulforhodamine B ethylenediamine |
| CAS Number: | N/A |
| Molecular Formula: | C29H37N4O6S2 |
| Molecular Weight: | 715.78 |
| SMILES: | OC(=O)C(F)(F)F.CCN(CC)C1=CC=C2C(OC3=CC(C=CC3=C2C2=CC=C(C=C2S(O)(=O)=O)S(=O)(=O)NCCN)=[N](CC)CC)=C1 |
| Purity (HPLC): | ≥ 95% |
| Shipping Conditions: | room temperature |
| Storage Conditions: | Refrigerated |
| Regulatory Statement: | For Research Use Only |
