Lissamine rhodamine B PEG3 alkyne
Lissamine rhodamine B PEG3 alkyne - 1mg is backordered and will ship as soon as it is back in stock.
Couldn't load pickup availability
Lissamine rhodamine B PEG3 alkyne
Sulforhodamine B PEG3 alkyne (Lissamine rhodamine B PEG3 alkyne) is an excellent azide-reactive fluorescent reagent for labeling azide-containing biological molecules through click chemistry. The conjugate has better solubility than the parent dye carboxyrhodamine and its long PEG spacer should reduce any steric effect of the dye on the molecule to be labelled. The fluorescence emission spectrum of Lissamine rhodamine B lies between those of tetramethylrhodamines and X-rhodamines, and it can be well excited by 568 nm line of the Ar-Kr mixed gas laser that is used in many confocal laser-scanning microscopes.
| Product Name: | Lissamine rhodamine B PEG3 alkyne |
| Synonyms: | Sulforhodamine B PEG3 alkyne |
| CAS Number: | N/A |
| Molecular Formula: | C36H45N3O9S2 |
| Molecular Weight: | 727.89 |
| SMILES: | CCN(CC)C1=CC=C2C(OC3=CC(C=CC3=C2C2=CC=C(C=C2S([O-])(=O)=O)S(=O)(=O)NCCOCCOCCOCC#C)=[N+](CC)CC)=C1 |
| Purity (HPLC): | ≥ 95% |
| Shipping Conditions: | room temperature |
| Storage Conditions: | Refrigerated |
| Regulatory Statement: | For Research Use Only |
