Proteolysis targeting chimera (PROTAC) building block. Contains an E3 ligase ligand substituted with alcohol. Ready for conjugation to a target protein ligand to form PROTACs containing 5'-substituted Lenalidomide as cereblon ligand.
| Product Name: | Phthalimidinoglutarimide-5'-C3-OH |
| Synonyms: | |
| CAS Number: | 2229725-44-2 |
| Molecular Formula: | C16H18N2O4 |
| Molecular Weight: | 302.33 |
| SMILES: | OCCCC1=CC=C2C(=O)N(CC2=C1)C1CCC(=O)NC1=O |
| Purity (HPLC): | 95% |
| Shipping Conditions: | room temperature |
| Storage Conditions: | Refrigerated |
| Regulatory Statement: | For Research Use Only |