Proteolysis targeting chimera (PROTAC) building block. Contains an E3 ligase ligand with alkyl linker and terminal amine. Ready for conjugation to a target protein ligand to form PROTACs containing Phthalimidinoglutarimide as cereblon ligand.
| Product Name: | Phthalimidinoglutarimide-C3-O-PEG3-C2-Br |
| Synonyms: | |
| CAS Number: | n/a |
| Molecular Formula: | C24H33BrN2O7 |
| Molecular Weight: | 541.439 |
| SMILES: | BrCCOCCOCCOCCOCCCC1=C2CN(C3CCC(=O)NC3=O)C(=O)C2=CC=C1 |
| Purity (HPLC): | 95% |
| Shipping Conditions: | room temperature |
| Storage Conditions: | Refrigerated |
| Regulatory Statement: | For Research Use Only |