Proteolysis targeting chimera (PROTAC) building block. Contains an E3 ligase ligand with PEG linker and terminal halide. Ready for conjugation to a target protein ligand to form PROTACs containing Pomalidomide as cereblon ligand.
| Product Name: | Pomalidomide-acetamido-O-PEG1-C2-Cl |
| Synonyms: | 2-[2-(2-Chloroethoxy)ethoxy]-N-[2-(2,6-dioxo-3-piperidinyl)-2,3-dihydro-1,3-dioxo-1H-isoindol-4-yl]acetamide |
| CAS Number: | 2162120-92-3 |
| Molecular Formula: | C19H20ClN3O7 |
| Molecular Weight: | 437.83 |
| SMILES: | ClCCOCCOCC(=O)NC1=C2C(=O)N(C3CCC(=O)NC3=O)C(=O)C2=CC=C1 |
| Purity (HPLC): | 95% |
| Shipping Conditions: | room temperature |
| Storage Conditions: | Refrigerated |
| Regulatory Statement: | For Research Use Only |