Proteolysis targeting chimera (PROTAC) building block. Contains an E3 ligase ligand with alkyl linker and terminal alkyne. Ready for conjugation to a target protein ligand through click reaction to form PROTACs containing Pomalidomide as cereblon ligand.
| Product Name: | Pomalidomide-C4-alkyne |
| Synonyms: | |
| CAS Number: | n/a |
| Molecular Formula: | C19H19N3O4 |
| Molecular Weight: | 353.378 |
| SMILES: | O=C1N(C2CCC(=O)NC2=O)C(=O)C2=C(NCCCCC#C)C=CC=C12 |
| Purity (HPLC): | 95% |
| Shipping Conditions: | room temperature |
| Storage Conditions: | Refrigerated |
| Regulatory Statement: | For Research Use Only |