Proteolysis targeting chimera (PROTAC) building block. Contains an E3 ligase ligand with alkyl linker and terminal amine. Ready for conjugation to a target protein ligand to form PROTACs containing Pomalidomide as cereblon ligand.
| Product Name: | Pomalidomide-C4-amine TFA |
| Synonyms: | 1H-?Isoindole-?1,?3(2H)?-?dione, 4-?[(4-?aminobutyl)?amino]?-?2-?(2,?6-?dioxo-?3-?piperidinyl)?-?, 2,?2,?2-?trifluoroacetate (1:1) |
| CAS Number: | 2093387-50-7 |
| Molecular Formula: | C19H21F3N4O6 |
| Molecular Weight: | 458.394 |
| SMILES: | OC(=O)C(F)(F)F.NCCCCNC1=C2C(=O)N(C3CCC(=O)NC3=O)C(=O)C2=CC=C1 |
| Purity (HPLC): | 95% |
| Shipping Conditions: | room temperature |
| Storage Conditions: | Refrigerated |
| Regulatory Statement: | For Research Use Only |