Proteolysis targeting chimera (PROTAC) building block. Contains an E3 ligase ligand with alkyl linker and terminal halide. Ready for conjugation to a target protein ligand to form PROTACs containing Pomalidomide as cereblon ligand.
| Product Name: | Pomalidomide-C6-Br |
| Synonyms: | 1H-?Isoindole-?1,?3(2H)?-?dione, 4-?[(6-?bromohexyl)?amino]?-?2-?(2,?6-?dioxo-?3-?piperidinyl)?- |
| CAS Number: | 2355289-53-9 |
| Molecular Formula: | C19H22BrN3O4 |
| Molecular Weight: | 436.306 |
| SMILES: | BrCCCCCCNC1=C2C(=O)N(C3CCC(=O)NC3=O)C(=O)C2=CC=C1 |
| Purity (HPLC): | 95% |
| Shipping Conditions: | room temperature |
| Storage Conditions: | Refrigerated |
| Regulatory Statement: | For Research Use Only |