Proteolysis targeting chimera (PROTAC) building block. Contains an E3 ligase ligand with alkyl linker and terminal halide. Ready for conjugation to a target protein ligand to form PROTACs containing Pomalidomide as cereblon ligand.
| Product Name: | Pomalidomide-CO-C3-Cl |
| Synonyms: | Butanamide, 4-?chloro-?N-?[2-?(2,?6-?dioxo-?3-?piperidinyl)?-?2,?3-?dihydro-?1,?3-?dioxo-?1H-?isoindol-?4-?yl]?- |
| CAS Number: | 2392004-41-8 |
| Molecular Formula: | C17H16ClN3O5 |
| Molecular Weight: | 377.78 |
| SMILES: | ClCCCC(=O)NC1=C2C(=O)N(C3CCC(=O)NC3=O)C(=O)C2=CC=C1 |
| Purity (HPLC): | 95% |
| Shipping Conditions: | room temperature |
| Storage Conditions: | Refrigerated |
| Regulatory Statement: | For Research Use Only |