Proteolysis targeting chimera (PROTAC) building block. Contains an E3 ligase ligand with PEG linker and terminal carboxylic acid. Ready for conjugation to a target protein ligand to form PROTACs containing Pomalidomide as cereblon ligand.
| Product Name: | Pomalidomide-PEG4-C2-acid |
| Synonyms: | Propanoic acid, 3-?[2-?[2-?[2-?[2-?[[2-?(2,?6-?dioxo-?3-?piperidinyl)?-?2,?3-?dihydro-?1,?3-?dioxo-?1H-?isoindol-?4-?yl]?amino]?ethoxy]?ethoxy]?ethoxy]?ethoxy]?- |
| CAS Number: | 2138440-81-8 |
| Molecular Formula: | C24H31N3O10 |
| Molecular Weight: | 521.523 |
| SMILES: | OC(=O)CCOCCOCCOCCOCCNC1=C2C(=O)N(C3CCC(=O)NC3=O)C(=O)C2=CC=C1 |
| Purity (HPLC): | 95% |
| Shipping Conditions: | room temperature |
| Storage Conditions: | Refrigerated |
| Regulatory Statement: | For Research Use Only |