Proteolysis targeting chimera (PROTAC) building block. Contains an E3 ligase ligand with PEG linker and terminal alkyne. Ready for conjugation to a target protein ligand through click reaction to form PROTACs containing Pomalidomide as cereblon ligand.
| Product Name: | Pomalidomide-PEG4-propargyl |
| Synonyms: | 1H-?Isoindole-?1,?3(2H)?-?dione, 2-?(2,?6-?dioxo-?3-?piperidinyl)?-?4-?(3,?6,?9,?12-?tetraoxapentadec-?14-?yn-?1-?ylamino)?- |
| CAS Number: | 2138439-58-2 |
| Molecular Formula: | C24H29N3O8 |
| Molecular Weight: | 487.509 |
| SMILES: | O=C1N(C2CCC(=O)NC2=O)C(=O)C2=C(NCCOCCOCCOCCOCC#C)C=CC=C12 |
| Purity (HPLC): | 95% |
| Shipping Conditions: | room temperature |
| Storage Conditions: | Refrigerated |
| Regulatory Statement: | For Research Use Only |