Pomalidomide-PEG6-C2-acid
$250.00
SKU: T52022-25mg
Proteolysis targeting chimera (PROTAC) building block. Contains an E3 ligase ligand with PEG linker and terminal carboxylic acid. Ready for conjugation to a target protein ligand to form PROTACs containing Pomalidomide as cereblon ligand.
| Product Name: | Pomalidomide-PEG6-C2-acid |
| Synonyms: | Propanoic acid, 3-?[[17-?[[2-?(2,?6-?dioxo-?3-?piperidinyl)?-?2,?3-?dihydro-?1,?3-?dioxo-?1H-?isoindol-?4-?yl]?amino]?-?3,?6,?9,?12,?15-?pentaoxaheptadec-?1-?yl]?oxy]?- |
| CAS Number: | 2225148-49-0 |
| Molecular Formula: | C28H39N3O12 |
| Molecular Weight: | 609.629 |
| SMILES: | OC(=O)CCOCCOCCOCCOCCOCCOCCNC1=C2C(=O)N(C3CCC(=O)NC3=O)C(=O)C2=CC=C1 |
| Purity (HPLC): | 95% |
| Shipping Conditions: | room temperature |
| Storage Conditions: | Refrigerated |
| Regulatory Statement: | For Research Use Only |