Proteolysis targeting chimera (PROTAC) building block. Contains (S,R,S)-AHPC as von Hippel-Lindau (VHL) ligand with PEG linker and a terminal amine moiety. Ready for conjugation to a target protein ligand to form PROTACs containing (S,R,S)-AHPC as E3 ligase ligand.
| Product Name: | (S,R,S)-AHPC-acetamido-O-PEG2-C2-amine HCl |
| Synonyms: | (2S,?4R)?-?1-?((S)?-?14-?Amino-?2-?(tert-?butyl)?-?4-?oxo-?6,?9,?12-?trioxa-?3-?azatetradecanoyl)?-?4-?hydroxy-?N-?(4-?(4-?methylthiazol-?5-?yl)?benzyl)?pyrrolidine-?2-?carboxamide |
| CAS Number: | 2097971-11-2 |
| Molecular Formula: | C30H46ClN5O7S |
| Molecular Weight: | 656.24 |
| SMILES: | Cl.CC1=C(SC=N1)C1=CC=C(CNC(=O)[C@@H]2C[C@@H](O)CN2C(=O)[C@@H](NC(=O)COCCOCCOCCN)C(C)(C)C)C=C1 |
| Purity (HPLC): | 95% |
| Shipping Conditions: | room temperature |
| Storage Conditions: | Refrigerated |
| Regulatory Statement: | For Research Use Only |