Proteolysis targeting chimera (PROTAC) building block. Contains (S,R,S)-AHPC as von Hippel-Lindau (VHL) ligand with alkyl linker and a terminal caboxylic acid moiety. Ready for conjugation to a target protein ligand to form PROTACs containing (S,R,S)-AHPC as E3 ligase ligand.
| Product Name: | (S,R,S)-AHPC-CO-C2-acid |
| Synonyms: | 4-?(((S)?-?1-?((2S,?4R)?-?4-?Hydroxy-?2-?((4-?(4-?methylthiazol-?5-?yl)?benzyl)?carbamoyl)?pyrrolidin-?1-?yl)?-?3,?3-?dimethyl-?1-?oxobutan-?2-?yl)?amino)?-?4-?oxobutanoic acid |
| CAS Number: | 2172819-72-4 |
| Molecular Formula: | C26H34N4O6S |
| Molecular Weight: | 530.64 |
| SMILES: | CC1=C(SC=N1)C1=CC=C(CNC(=O)[C@@H]2C[C@@H](O)CN2C(=O)[C@@H](NC(=O)CCC(O)=O)C(C)(C)C)C=C1 |
| Purity (HPLC): | 95% |
| Shipping Conditions: | room temperature |
| Storage Conditions: | Refrigerated |
| Regulatory Statement: | For Research Use Only |