Proteolysis targeting chimera (PROTAC) building block. Contains (S,R,S)-AHPC as von Hippel-Lindau (VHL) ligand with alkyl linker and a terminal alkyne moiety. Ready for conjugation to a target protein ligand to form PROTACs containing (S,R,S)-AHPC as E3 ligase ligand.
| Product Name: | (S,R,S)-AHPC-CO-C3-alkyne |
| Synonyms: | |
| CAS Number: | |
| Molecular Formula: | C28H36N4O4S |
| Molecular Weight: | 524.68 |
| SMILES: | CC1=C(SC=N1)C1=CC=C(CNC(=O)[C@@H]2C[C@@H](O)CN2C(=O)[C@@H](NC(=O)CCCC#C)C(C)(C)C)C=C1 |
| Purity (HPLC): | 95% |
| Shipping Conditions: | room temperature |
| Storage Conditions: | Refrigerated |
| Regulatory Statement: | For Research Use Only |