Proteolysis targeting chimera (PROTAC) building block. Contains (S,R,S)-AHPC as von Hippel-Lindau (VHL) ligand with alkyl linker and a terminal caboxylic acid moiety. Ready for conjugation to a target protein ligand to form PROTACs containing (S,R,S)-AHPC as E3 ligase ligand.
| Product Name: | (S,R,S)-AHPC-CO-C9-acid |
| Synonyms: | L-?Prolinamide, N-?(10-?carboxy-?1-?oxodecyl)?-?3-?methyl-?L-?valyl-?4-?hydroxy-?N-?[[4-?(4-?methyl-?5-?thiazolyl)?phenyl]?methyl]?-?, (4R)?- |
| CAS Number: | 2172819-78-0 |
| Molecular Formula: | C33H48N4O6S |
| Molecular Weight: | 628.83 |
| SMILES: | CC1=C(SC=N1)C1=CC=C(CNC(=O)[C@@H]2C[C@@H](O)CN2C(=O)[C@@H](NC(=O)CCCCCCCCCC(O)=O)C(C)(C)C)C=C1 |
| Purity (HPLC): | 95% |
| Shipping Conditions: | room temperature |
| Storage Conditions: | Refrigerated |
| Regulatory Statement: | For Research Use Only |