(S,R,S)-AHPC (HCl salt) is an E3 ligase ligand used in the recruitment of the von Hippel-Lindau (VHL) protein for targeted protein degradation.
| Product Name: | (S,R,S)-AHPC hydrochloride |
| Synonyms: | VH032-NH2; VHL ligand 1 |
| CAS Number: | 1448189-80-7 |
| Molecular Formula: | C22H31ClN4O3S |
| Molecular Weight: | 467.03 |
| SMILES: | Cl.CC1=C(SC=N1)C1=CC=C(CNC(=O)[C@@H]2C[C@@H](O)CN2C(=O)[C@@H](N)C(C)(C)C)C=C1 |
| Purity (HPLC): | 95% |
| Shipping Conditions: | room temperature |
| Storage Conditions: | Refrigerated |
| Regulatory Statement: | For Research Use Only |