Proteolysis targeting chimera (PROTAC) building block. Contains an E3 ligase ligand substituted with alkyne. Ready for conjugation to a target protein ligand to form PROTACs containing 5'-substituted Thalidomide as cereblon ligand.
| Product Name: | Thalidomide-5'-O-C5-alkyne |
| Synonyms: | |
| CAS Number: | n/a |
| Molecular Formula: | C20H20N2O5 |
| Molecular Weight: | 368.389 |
| SMILES: | O=C1N(C2CCC(=O)NC2=O)C(=O)C2=CC(OCCCCCC#C)=CC=C12 |
| Purity (HPLC): | 95% |
| Shipping Conditions: | room temperature |
| Storage Conditions: | Refrigerated |
| Regulatory Statement: | For Research Use Only |