Proteolysis targeting chimera (PROTAC) building block. Contains an E3 ligase ligand with alkyl linker and terminal amine. Ready for conjugation to a target protein ligand to form PROTACs containing Thalidomide as cereblon ligand.
| Product Name: | Thalidomide-O-acetamido-C6-amine HCl |
| Synonyms: | Acetamide, N-?(6-?aminohexyl)?-?2-?[[2-?(2,?6-?dioxo-?3-?piperidinyl)?-?2,?3-?dihydro-?1,?3-?dioxo-?1H-?isoindol-?4-?yl]?oxy]?-?, hydrochloride (1:1) |
| CAS Number: | 2376990-31-5 |
| Molecular Formula: | C21H27ClN4O6 |
| Molecular Weight: | 466.92 |
| SMILES: | Cl.NCCCCCCNC(=O)COC1=C2C(=O)N(C3CCC(=O)NC3=O)C(=O)C2=CC=C1 |
| Purity (HPLC): | 95% |
| Shipping Conditions: | room temperature |
| Storage Conditions: | Refrigerated |
| Regulatory Statement: | For Research Use Only |