Proteolysis targeting chimera (PROTAC) building block. Contains an E3 ligase ligand with PEG linker and terminal azide. Ready for conjugation to a target protein ligand through click chemistry to form PROTACs containing Thalidomide as cereblon ligand.
| Product Name: | Thalidomide-O-acetamido-PEG3-C2-azide |
| Synonyms: | Acetamide, N-?[2-?[2-?[2-?(2-?azidoethoxy)?ethoxy]?ethoxy]?ethyl]?-?2-?[[2-?(2,?6-?dioxo-?3-?piperidinyl)?-?2,?3-?dihydro-?1,?3-?dioxo-?1H-?isoindol-?4-?yl]?oxy]?- |
| CAS Number: | 2402790-58-1 |
| Molecular Formula: | C23H28N6O9 |
| Molecular Weight: | 532.51 |
| SMILES: | [N-]=[N+]=NCCOCCOCCOCCNC(=O)COC1=C2C(=O)N(C3CCC(=O)NC3=O)C(=O)C2=CC=C1 |
| Purity (HPLC): | 95% |
| Shipping Conditions: | room temperature |
| Storage Conditions: | Refrigerated |
| Regulatory Statement: | For Research Use Only |