Proteolysis targeting chimera (PROTAC) building block. Contains an E3 ligase ligand with alkyl linker and terminal carboxylic acid. Ready for conjugation to a target protein ligand to form PROTACs containing Thalidomide as cereblon ligand.
| Product Name: | Thalidomide-O-C4-acid |
| Synonyms: | 5-[[2-(2,6-Dioxo-3-piperidinyl)-2,3-dihydro-1,3-dioxo-1H-isoindol-4-yl]oxy]pentanoic acid |
| CAS Number: | 2169266-67-3 |
| Molecular Formula: | C18H18N2O7 |
| Molecular Weight: | 374.349 |
| SMILES: | OC(=O)CCCCOC1=C2C(=O)N(C3CCC(=O)NC3=O)C(=O)C2=CC=C1 |
| Purity (HPLC): | 95% |
| Shipping Conditions: | room temperature |
| Storage Conditions: | Refrigerated |
| Regulatory Statement: | For Research Use Only |