Proteolysis targeting chimera (PROTAC) building block. Contains an E3 ligase ligand with PEG linker and terminal alcohol. Ready for conjugation to a target protein ligand to form PROTACs containing Thalidomide as cereblon ligand.
| Product Name: | Thalidomide-O-C5-OH |
| Synonyms: | 1H-?Isoindole-?1,?3(2H)?-?dione, 2-?(2,?6-?dioxo-?3-?piperidinyl)?-?4-?[(5-?hydroxypentyl)?oxy]?- |
| CAS Number: | 2411099-10-8 |
| Molecular Formula: | C18H20N2O6 |
| Molecular Weight: | 360.366 |
| SMILES: | OCCCCCOC1=C2C(=O)N(C3CCC(=O)NC3=O)C(=O)C2=CC=C1 |
| Purity (HPLC): | 95% |
| Shipping Conditions: | room temperature |
| Storage Conditions: | Refrigerated |
| Regulatory Statement: | For Research Use Only |