Proteolysis targeting chimera (PROTAC) building block. Contains an E3 ligase ligand with alkyl linker and terminal azide. Ready for conjugation to a target protein ligand through click chemistry to form PROTACs containing Thalidomide as cereblon ligand.
| Product Name: | Thalidomide-O-C6-azide |
| Synonyms: | 1H-?Isoindole-?1,?3(2H)?-?dione, 4-?[(6-?azidohexyl)?oxy]?-?2-?(2,?6-?dioxo-?3-?piperidinyl)?- |
| CAS Number: | 2411389-65-4 |
| Molecular Formula: | C19H21N5O5 |
| Molecular Weight: | 399.407 |
| SMILES: | [N-]=[N+]=NCCCCCCOC1=C2C(=O)N(C3CCC(=O)NC3=O)C(=O)C2=CC=C1 |
| Purity (HPLC): | 95% |
| Shipping Conditions: | room temperature |
| Storage Conditions: | Refrigerated |
| Regulatory Statement: | For Research Use Only |