Proteolysis targeting chimera (PROTAC) building block. Contains an E3 ligase ligand with PEG linker and terminal alcohol. Ready for conjugation to a target protein ligand to form PROTACs containing Thalidomide as cereblon ligand.
| Product Name: | Thalidomide-O-PEG3-OH |
| Synonyms: | 2-(2,6-Dioxo-3-piperidinyl)-4-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]-1H-isoindole-1,3(2H)-dione |
| CAS Number: | 2286368-57-6 |
| Molecular Formula: | C19H22N2O8 |
| Molecular Weight: | 406.391 |
| SMILES: | OCCOCCOCCOC1=C2C(=O)N(C3CCC(=O)NC3=O)C(=O)C2=CC=C1 |
| Purity (HPLC): | 95% |
| Shipping Conditions: | room temperature |
| Storage Conditions: | Refrigerated |
| Regulatory Statement: | For Research Use Only |