Proteolysis targeting chimera (PROTAC) building block. Contains an E3 ligase ligand with alkyl linker and terminal alkyne. Ready for conjugation to a target protein ligand through click chemistry to form PROTACs containing Thalidomide as cereblon ligand.
| Product Name: | Thalidomide-O-propargyl |
| Synonyms: | 2-(2,6-Dioxopiperidin-3-yl)-4-(prop-2-yn-1-yloxy]isoindoline-1,3-dione |
| CAS Number: | 2098487-39-7 |
| Molecular Formula: | C16H12N2O5 |
| Molecular Weight: | 312.281 |
| SMILES: | O=C1N(C2CCC(=O)NC2=O)C(=O)C2=C(OCC#C)C=CC=C12 |
| Purity (HPLC): | 95% |
| Shipping Conditions: | room temperature |
| Storage Conditions: | Refrigerated |
| Regulatory Statement: | For Research Use Only |